* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 2,4-DIOXO-4-(PYRAZIN-2-YL)BUTANOATE |
| CAS: | 741288-60-8 |
| English Synonyms: | ETHYL 2,4-DIOXO-4-(PYRAZIN-2-YL)BUTANOATE |
| MDL Number.: | MFCD14707581 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C(=O)CC(=O)c1cnccn1 |
| InChi: | InChI=1S/C10H10N2O4/c1-2-16-10(15)9(14)5-8(13)7-6-11-3-4-12-7/h3-4,6H,2,5H2,1H3 |
| InChiKey: | InChIKey=HAZIQQYVXHOTGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.