* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,4,7,8-TETRAHYDRO-2H,6H-PYRIMIDO[2,1-B][1,3]THIAZINE |
| CAS: | 742015-57-2 |
| English Synonyms: | 3,4,7,8-TETRAHYDRO-2H,6H-PYRIMIDO[2,1-B][1,3]THIAZINE |
| MDL Number.: | MFCD18814063 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1CN=C2N(C1)CCCS2 |
| InChi: | InChI=1S/C7H12N2S/c1-3-8-7-9(4-1)5-2-6-10-7/h1-6H2 |
| InChiKey: | InChIKey=UQSOGZXHDSPWFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.