* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 3-BROMO-2-METHYL-6-NITRO-2H-INDAZOLE |
| CAS: | 74209-41-9 |
| EnglishSynonyms: | 3-BROMO-2-METHYL-6-NITRO-2H-INDAZOLE |
| pro_mdlNumber: | MFCD02666041 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | Cn1c(c2ccc(cc2n1)[N+](=O)[O-])Br |
| InChi: | InChI=1S/C8H6BrN3O2/c1-11-8(9)6-3-2-5(12(13)14)4-7(6)10-11/h2-4H,1H3 |
| InChiKey: | InChIKey=RQSRFUOTGACRJJ-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 174-176 DEG |
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.