* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(2-AMINO-ETHYL)-2-ETHOXY-PHENOL |
CAS: | 74321-37-2 |
English Synonyms: | 4-(2-AMINO-ETHYL)-2-ETHOXY-PHENOL |
MDL Number.: | MFCD00060622 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCOc1cc(ccc1O)CCN |
InChi: | InChI=1S/C10H15NO2/c1-2-13-10-7-8(5-6-11)3-4-9(10)12/h3-4,7,12H,2,5-6,11H2,1H3 |
InChiKey: | InChIKey=UIUMGHFVRJSGKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.