* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-O-METHYL-D-XYLOSE |
CAS: | 7434-28-8 |
English Synonyms: | 2-O-METHYL-D-XYLOSE |
MDL Number.: | MFCD00069809 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CO[C@@H]1[C@H]([C@@H](COC1O)O)O |
InChi: | InChI=1S/C6H12O5/c1-10-5-4(8)3(7)2-11-6(5)9/h3-9H,2H2,1H3/t3-,4+,5-,6?/m1/s1 |
InChiKey: | InChIKey=UAXFCDNRLADBDZ-IANNHFEVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.