* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Tyrosine, O-(4-chlorophenyl)- |
CAS: | 74649-65-3 |
English Synonyms: | TYROSINE, O-(4-CHLOROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC1=CC=C(C=C1)OC1=CC=C(C[C@H](N)C(=O)O)C=C1 |
InChi: | InChI=1S/C15H14ClNO3/c16-11-3-7-13(8-4-11)20-12-5-1-10(2-6-12)9-14(17)15(18)19/h1-8,14H,9,17H2,(H,18,19)/t14-/m0/s1 |
InChiKey: | InChIKey=JQOKVGVGZKRMFJ-AWEZNQCLSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.