* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XR 334 |
| CAS: | 74720-35-7 |
| English Synonyms: | XR 334 |
| MDL Number.: | MFCD00928297 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | COc1ccc(cc1)/C=c\2/c(=O)[nH]/c(=C\c3ccccc3)/c(=O)[nH]2 |
| InChi: | InChI=1S/C19H16N2O3/c1-24-15-9-7-14(8-10-15)12-17-19(23)20-16(18(22)21-17)11-13-5-3-2-4-6-13/h2-12H,1H3,(H,20,23)(H,21,22)/b16-11-,17-12- |
| InChiKey: | InChIKey=QMUALMJMQXNBIA-LSQIQBGYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.