* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO[1,2,4]TRIAZOLO[1,5-A]PYRAZINE |
| CAS: | 74803-32-0 |
| English Synonyms: | 8-CHLORO[1,2,4]TRIAZOLO[1,5-A]PYRAZINE |
| MDL Number.: | MFCD09834989 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cn2c(c(n1)Cl)ncn2 |
| InChi: | InChI=1S/C5H3ClN4/c6-4-5-8-3-9-10(5)2-1-7-4/h1-3H |
| InChiKey: | InChIKey=VZMFNXVRYOJRMK-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.