* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[2-(2S)-2-PYRROLIDINYLETHYL]-PYRIDINE |
CAS: | 748789-03-9 |
English Synonyms: | 2-[2-(2S)-2-PYRROLIDINYLETHYL]-PYRIDINE |
MDL Number.: | MFCD12546294 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccnc(c1)CC[C@@H]2CCCN2 |
InChi: | InChI=1S/C11H16N2/c1-2-8-12-10(4-1)6-7-11-5-3-9-13-11/h1-2,4,8,11,13H,3,5-7,9H2/t11-/m0/s1 |
InChiKey: | InChIKey=UTQRWQYEEUMJOA-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.