* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(AZETIDIN-1-YL)-2-OXOACETIC ACID |
CAS: | 749177-98-8 |
English Synonyms: | 2-(AZETIDIN-1-YL)-2-OXOACETIC ACID |
MDL Number.: | MFCD17012863 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C1CN(C1)C(=O)C(=O)O |
InChi: | InChI=1S/C5H7NO3/c7-4(5(8)9)6-2-1-3-6/h1-3H2,(H,8,9) |
InChiKey: | InChIKey=SKXPOIQAAMIVEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.