Molecular Structure:
CAS No.:
75013-51-3
Product Name.:
CCD No.:CCD00073431
Formula:C6 H11 O6 T
MolWeight:182.163
![L-GLUCOSE-[1-3H(N)] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(8)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | L-GLUCOSE-[1-3H(N)] |
| CAS： | 75013-51-3 |
| English Synonyms： | L-GLUCOSE, [1-3H]- ; GLUCOSE, L-[1-3H(N)] ; L-GLUCOSE-[1-3H(N)] |
| MDL Number.： | MFCD00148914 |
| H bond acceptor： | 6 |
| H bond donor： | 5 |
| Smile： | [3H]C(=O)[C@H]([C@@H]([C@H]([C@H](CO)O)O)O)O |
| InChiKey： | InChIKey=null |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
