* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1-(2-CHLOROETHYL)-4-IODOBENZENE |
CAS: | 75067-07-1 |
English Synonyms: | 1-(2-CHLOROETHYL)-4-IODOBENZENE |
MDL Number.: | MFCD11521295 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1cc(ccc1CCCl)I |
InChi: | InChI=1S/C8H8ClI/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
InChiKey: | InChIKey=IJOBLCDSBNBQQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.