* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CUCURBITACIN H |
| CAS: | 751-95-1 |
| English Synonyms: | CUCURBITACIN H |
| MDL Number.: | MFCD17676140 |
| H bond acceptor: | 8 |
| H bond donor: | 5 |
| Smile: | CC1(C2=CC[C@H]3[C@@]4(C[C@H]([C@@H]([C@]4(CC(=O)[C@]3([C@@H]2C[C@@H](C1=O)O)C)C)[C@](C)(C(=O)CC(C(C)(C)O)O)O)O)C)C |
| InChi: | InChI=1S/C30H46O8/c1-25(2)15-9-10-19-27(5)13-18(32)23(30(8,38)21(34)12-20(33)26(3,4)37)28(27,6)14-22(35)29(19,7)16(15)11-17(31)24(25)36/h9,16-20,23,31-33,37-38H,10-14H2,1-8H3/t16-,17+,18-,19+,20?,23+,27+,28-,29+,30+/m1/s1 |
| InChiKey: | InChIKey=ABNDMUIXCBUBLO-REQJDAJISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.