* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2-CHLOROETHYL)-3H-PYRIMIDO[5,4-B]INDOL-4(5H)-ONE |
CAS: | 751478-29-2 |
English Synonyms: | 3-(2-CHLOROETHYL)-3H-PYRIMIDO[5,4-B]INDOL-4(5H)-ONE |
MDL Number.: | MFCD12828359 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c3c([nH]2)c(=O)n(cn3)CCCl |
InChi: | InChI=1S/C12H10ClN3O/c13-5-6-16-7-14-10-8-3-1-2-4-9(8)15-11(10)12(16)17/h1-4,7,15H,5-6H2 |
InChiKey: | InChIKey=YMHMHAYRMOWNIP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.