* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(Boc-amino)-2-butanol |
CAS: | 752135-63-0 |
English Synonyms: | 3-(BOC-AMINO)-2-BUTANOL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)NC(C(C)O)C |
InChi: | InChI=1S/C9H19NO3/c1-6(7(2)11)10-8(12)13-9(3,4)5/h6-7,11H,1-5H3,(H,10,12) |
InChiKey: | InChIKey=CHYWVAGOJXWXIK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.