* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRROLO[1,2-A]THIENO[2,3-E]PYRAZINE |
| CAS: | 75214-39-0 ;75214-38-9 |
| English Synonyms: | PYRROLO[1,2-A]THIENO[3,2-E]PYRAZINE ; PYRROLO[1,2-A]THIENO[2,3-E]PYRAZINE |
| MDL Number.: | MFCD13178469 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc2cnc3c(n2c1)ccs3 |
| InChi: | InChI=1S/C9H6N2S/c1-2-7-6-10-9-8(3-5-12-9)11(7)4-1/h1-6H |
| InChiKey: | InChIKey=FHIGHEZQZRKYKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.