* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Naphthalene, 1-(2-iodoethyl)- |
CAS: | 75325-81-4 |
English Synonyms: | NAPHTHALENE, 1-(2-IODOETHYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ICCC1=CC=CC2=CC=CC=C12 |
InChi: | InChI=1S/C12H11I/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2 |
InChiKey: | InChIKey=NEIMZZNLXTVJOB-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.