* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-GLY-LEU-NH2 |
CAS: | 7535-72-0 |
English Synonyms: | Z-GLYCYL-L-LEUCINE AMIDE ; Z-GLY-LEU-NH2 |
MDL Number.: | MFCD00070668 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(C)C[C@@H](C(=O)N)NC(=O)CNC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C16H23N3O4/c1-11(2)8-13(15(17)21)19-14(20)9-18-16(22)23-10-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H2,17,21)(H,18,22)(H,19,20)/t13-/m0/s1 |
InChiKey: | InChIKey=YNCAXHGPWXYIPH-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.