* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-FLUORO-1,2,3,4-TETRAHYDROQUINOLINE |
| CAS: | 75414-02-7 |
| English Synonyms: | 8-FLUORO-1,2,3,4-TETRAHYDROQUINOLINE |
| MDL Number.: | MFCD09041601 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1cc2c(c(c1)F)NCCC2 |
| InChi: | InChI=1S/C9H10FN/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1,3,5,11H,2,4,6H2 |
| InChiKey: | InChIKey=WJHPXUGHFGUTHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.