* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3H-1,2,4-TRIAZOL-3-ONE, 5-AMINO-2,4-DIHYDRO-2,4-DIMETHYL-, HYDRAZONE |
CAS: | 754201-52-0 |
English Synonyms: | 3H-1,2,4-TRIAZOL-3-ONE, 5-AMINO-2,4-DIHYDRO-2,4-DIMETHYL-, HYDRAZONE |
MDL Number.: | MFCD18830110 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cn\1c(nn(/c1=N/N)C)N |
InChi: | InChI=1S/C4H10N6/c1-9-3(5)8-10(2)4(9)7-6/h6H2,1-2H3,(H2,5,8)/b7-4+ |
InChiKey: | InChIKey=JPAXOZBDUUXZAK-QPJJXVBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.