* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,4,5,6-HEXAHYDROAZEPINO[4,5-B]INDOLE |
CAS: | 7546-78-3 |
English Synonyms: | 1,2,3,4,5,6-HEXAHYDROAZEPINO[4,5-B]INDOLE |
MDL Number.: | MFCD11846948 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c3c([nH]2)CCNCC3 |
InChi: | InChI=1S/C12H14N2/c1-2-4-11-9(3-1)10-5-7-13-8-6-12(10)14-11/h1-4,13-14H,5-8H2 |
InChiKey: | InChIKey=NGUNYFTXLWTSNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.