* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-CHLORO-3H-INDOLE |
| CAS: | 754948-43-1 |
| English Synonyms: | 5-CHLORO-3H-INDOLE ; 3H-INDOLE, 5-CHLORO- |
| MDL Number.: | MFCD13177538 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1Cl)CC=N2 |
| InChi: | InChI=1S/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,4-5H,3H2 |
| InChiKey: | InChIKey=UZALROHLTCSLJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.