* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6(5H)-Pteridinone, 2-chloro-8-cyclopentyl-7,8-dihydro-7-methyl-, (7R)- |
CAS: | 755039-49-7 |
English Synonyms: | 6(5H)-PTERIDINONE, 2-CHLORO-8-CYCLOPENTYL-7,8-DIHYDRO-7-METHYL-, (7R)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC1=NC=2N([C@@H](C(NC2C=N1)=O)C)C1CCCC1 |
InChi: | InChI=1S/C12H15ClN4O/c1-7-11(18)15-9-6-14-12(13)16-10(9)17(7)8-4-2-3-5-8/h6-8H,2-5H2,1H3,(H,15,18)/t7-/m1/s1 |
InChiKey: | InChIKey=IBNRVNCIECLLGE-SSDOTTSWSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.