* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3R)-1-ETHYLPYRROLIDIN-3-AMINE |
CAS: | 755039-92-0 |
English Synonyms: | (3R)-1-ETHYLPYRROLIDIN-3-AMINE ; 3-PYRROLIDINAMINE, 1-ETHYL-, (3R)- |
MDL Number.: | MFCD17214740 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCN1CC[C@H](C1)N |
InChi: | InChI=1S/C6H14N2/c1-2-8-4-3-6(7)5-8/h6H,2-5,7H2,1H3/t6-/m1/s1 |
InChiKey: | InChIKey=GOLVGZOPWLLUSF-ZCFIWIBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.