* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINAZOLIN-5-OL |
| CAS: | 7556-88-9 |
| English Synonyms: | 5-QUINAZOLINOL ; QUINAZOLIN-5-OL |
| MDL Number.: | MFCD00956154 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cncn2)c(c1)O |
| InChi: | InChI=1S/C8H6N2O/c11-8-3-1-2-7-6(8)4-9-5-10-7/h1-5,11H |
| InChiKey: | InChIKey=ATQUABCIJINPMX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.