* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SUC-PHE-LEU-PHE-PNA |
CAS: | 75651-69-3 |
English Synonyms: | SUC-PHE-LEU-PHE-PNA |
MDL Number.: | MFCD00038842 |
H bond acceptor: | 13 |
H bond donor: | 5 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc2ccc(cc2)[N+](=O)[O-])NC(=O)[C@H](Cc3ccccc3)NC(=O)CCC(=O)O |
InChi: | InChI=1S/C34H39N5O8/c1-22(2)19-27(37-34(45)28(20-23-9-5-3-6-10-23)36-30(40)17-18-31(41)42)33(44)38-29(21-24-11-7-4-8-12-24)32(43)35-25-13-15-26(16-14-25)39(46)47/h3-16,22,27-29H,17-21H2,1-2H3,(H,35,43)(H,36,40)(H,37,45)(H,38,44)(H,41,42)/t27-,28-,29-/m0/s1 |
InChiKey: | InChIKey=ZDFAXGKOHVNQOY-AWCRTANDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.