* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-ETHYL-1H-PYRAZOL-4-OL |
| CAS: | 75702-85-1 |
| English Synonyms: | 1-ETHYLPYRAZOL-4-OL ; 1-ETHYL-1H-PYRAZOL-4-OL |
| MDL Number.: | MFCD04969811 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCn1cc(cn1)O |
| InChi: | InChI=1S/C5H8N2O/c1-2-7-4-5(8)3-6-7/h3-4,8H,2H2,1H3 |
| InChiKey: | InChIKey=RWONCMDCEBQRLV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.