* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-CHLORO-6-(1H-1,2,4-TRIAZOL-1-YL)PYRIDAZINE |
CAS: | 75792-73-3 |
English Synonyms: | 3-CHLORO-6-(1H-1,2,4-TRIAZOL-1-YL)PYRIDAZINE |
MDL Number.: | MFCD11621995 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc(nnc1n2cncn2)Cl |
InChi: | InChI=1S/C6H4ClN5/c7-5-1-2-6(11-10-5)12-4-8-3-9-12/h1-4H |
InChiKey: | InChIKey=ZDKYCLHKQCVJCK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.