Molecular Structure:
CAS No.:
757966-64-6
Product Name.:
CCD No.:CCD02376695
Formula:C8 H9 N3 O
MolWeight:163.179
![4,5-DIHYDRO-1H-PYRIDO[2,3-B][1,4]DIAZEPIN-2(3H)-ONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(10)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(4)
|
|
| Product Name： | 4,5-DIHYDRO-1H-PYRIDO[2,3-B][1,4]DIAZEPIN-2(3H)-ONE |
| CAS： | 757966-64-6 |
| English Synonyms： | 4,5-DIHYDRO-1H-PYRIDO[2,3-B][1,4]DIAZEPIN-2(3H)-ONE ; 1H,2H,3H,4H,5H-PYRIDO[2,3-B][1,4]DIAZEPIN-2-ONE ; 1,3,4,5-TETRAHYDRO-2H-PYRIDO[2,3-B][1,4]DIAZEPIN-2-ONE ; 4,5-DIHYDRO-1H-PYRIDO[3,2-B][1,4]DIAZEPIN-2(3H)-ONE ; 1H,3H,4H,5H-PYRIDO[2,3-B][1,4]DIAZEPIN-2-ONE |
| MDL Number.： | MFCD14705116 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1cc2c(nc1)NCCC(=O)N2 |
| InChi： | InChI=1S/C8H9N3O/c12-7-3-5-10-8-6(11-7)2-1-4-9-8/h1-2,4H,3,5H2,(H,9,10)(H,11,12) |
| InChiKey： | InChIKey=FTJBUDNRWYUVDD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
