* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1460 |
CAS: | 758632-69-8 |
English Synonyms: | ABBYPHARMA AP-10-1460 |
MDL Number.: | MFCD16988079 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | OC(=O)CC1=NC=CC(=O)N1 |
InChi: | InChI=1S/C6H6N2O3/c9-5-1-2-7-4(8-5)3-6(10)11/h1-2H,3H2,(H,10,11)(H,7,8,9) |
InChiKey: | InChIKey=BEWKKMLJDPKZPG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.