* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FURAPYRIMIDONE |
| CAS: | 75888-03-8 |
| English Synonyms: | FURAPYRIMIDONE |
| MDL Number.: | MFCD01688976 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | c1cc(oc1/C=N/N2CCCNC2=O)[N+](=O)[O-] |
| InChi: | InChI=1S/C9H10N4O4/c14-9-10-4-1-5-12(9)11-6-7-2-3-8(17-7)13(15)16/h2-3,6H,1,4-5H2,(H,10,14)/b11-6+ |
| InChiKey: | InChIKey=NITMRIAAAKECLS-IZZDOVSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.