* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(BENZYLOXY)-1,2,3,4-TETRAHYDROQUINOLINE |
| CAS: | 75893-80-0 |
| English Synonyms: | 6-(BENZYLOXY)-1,2,3,4-TETRAHYDROQUINOLINE |
| MDL Number.: | MFCD11126886 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)COc2ccc3c(c2)CCCN3 |
| InChi: | InChI=1S/C16H17NO/c1-2-5-13(6-3-1)12-18-15-8-9-16-14(11-15)7-4-10-17-16/h1-3,5-6,8-9,11,17H,4,7,10,12H2 |
| InChiKey: | InChIKey=IIBAIGFSRDHPLM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.