* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CIAMEXON |
CAS: | 75985-31-8 |
English Synonyms: | CIAMEXON |
MDL Number.: | MFCD00867584 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1ccc(c(n1)OC)CN2CC2C#N |
InChi: | InChI=1S/C11H13N3O/c1-8-3-4-9(11(13-8)15-2)6-14-7-10(14)5-12/h3-4,10H,6-7H2,1-2H3 |
InChiKey: | InChIKey=KOYMTVWMCXDJNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.