* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Pentenoic acid, 2-cyano-4-methyl- |
CAS: | 760-58-7 |
English Synonyms: | 2-PENTENOIC ACID, 2-CYANO-4-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(#N)C(C(=O)O)=CC(C)C |
InChi: | InChI=1S/C7H9NO2/c1-5(2)3-6(4-8)7(9)10/h3,5H,1-2H3,(H,9,10) |
InChiKey: | InChIKey=JYFREZOLRUHBAQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.