Molecular Structure:
CAS No.:
76006-01-4
Product Name.:
CCD No.:CCD03281784
Formula:C9 H9 N3 O
MolWeight:175.19
![ETHANONE, 1-(5-METHYL-PYRAZOLO[3,4-C]PYRIDIN-1-YL)- Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ETHANONE, 1-(5-METHYL-PYRAZOLO[3,4-C]PYRIDIN-1-YL)- |
| CAS： | 76006-01-4 |
| English Synonyms： | ETHANONE, 1-(5-METHYL-PYRAZOLO[3,4-C]PYRIDIN-1-YL)- |
| MDL Number.： | MFCD17010073 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | Cc1cc2cnn(c2cn1)C(=O)C |
| InChi： | InChI=1S/C9H9N3O/c1-6-3-8-4-11-12(7(2)13)9(8)5-10-6/h3-5H,1-2H3 |
| InChiKey： | InChIKey=BLJPFSGJXUXHEY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
