* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-Benzenediamine, N1-(2-aminoethyl)- |
CAS: | 76045-64-2 |
English Synonyms: | 1,3-BENZENEDIAMINE, N1-(2-AMINOETHYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NCCNC1=CC(=CC=C1)N |
InChi: | InChI=1S/C8H13N3/c9-4-5-11-8-3-1-2-7(10)6-8/h1-3,6,11H,4-5,9-10H2 |
InChiKey: | InChIKey=LRZCBJYTBUZEFK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.