* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-ETHOXY-BUTAN-2-ONE |
CAS: | 76086-05-0 |
English Synonyms: | 1-ETHOXY-BUTAN-2-ONE |
MDL Number.: | MFCD12545812 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(=O)COCC |
InChi: | InChI=1S/C6H12O2/c1-3-6(7)5-8-4-2/h3-5H2,1-2H3 |
InChiKey: | InChIKey=FRFMOVPIHHDDPP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.