* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-PROPANONE, 2-AMINO-1-(1-ETHYL-1H-INDOL-3-YL)-2-METHYL- |
| CAS: | 761338-34-5 |
| English Synonyms: | 1-PROPANONE, 2-AMINO-1-(1-ETHYL-1H-INDOL-3-YL)-2-METHYL- ; 2-AMINO-1-(1-ETHYL-1H-INDOL-3-YL)-2-METHYL-1-PROPANONE |
| MDL Number.: | MFCD18811134 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCn1cc(c2c1cccc2)C(=O)C(C)(C)N |
| InChi: | InChI=1S/C14H18N2O/c1-4-16-9-11(13(17)14(2,3)15)10-7-5-6-8-12(10)16/h5-9H,4,15H2,1-3H3 |
| InChiKey: | InChIKey=FTLURXHRHYMYBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.