Molecular Structure:
CAS No.:
761374-88-3
Product Name.:
CCD No.:CCD00692289
Formula:C3 Cl D7
MolWeight:85.584
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1-CHLOROPROPANE-D7 |
| CAS： | 761374-88-3 |
| English Synonyms： | 1-CHLOROPROPANE-D7 ; N-PROPYL CHLORIDE-D7 |
| MDL Number.： | MFCD08704976 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])Cl |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
