* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PROPOXY-3-(1H-TETRAZOL-5-YL)-2H-1-BENZOPYRAN-2-ONE |
| CAS: | 76239-29-7 |
| English Synonyms: | 7-PROPOXY-3-(1H-TETRAZOL-5-YL)-2H-1-BENZOPYRAN-2-ONE |
| MDL Number.: | MFCD01762884 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCCOc1ccc2cc(c(=O)oc2c1)c3[nH]nnn3 |
| InChi: | InChI=1S/C13H12N4O3/c1-2-5-19-9-4-3-8-6-10(12-14-16-17-15-12)13(18)20-11(8)7-9/h3-4,6-7H,2,5H2,1H3,(H,14,15,16,17) |
| InChiKey: | InChIKey=NTKFLZCRIBRSEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.