* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-((4-AMINO-5-(3-MEO-PH)-4H-1,2,4-TRIAZOL-3-YL)THIO)-N-(2,6-DI-ME-PH)ACETAMIDE |
CAS: | 763114-89-2 |
English Synonyms: | 2-((4-AMINO-5-(3-MEO-PH)-4H-1,2,4-TRIAZOL-3-YL)THIO)-N-(2,6-DI-ME-PH)ACETAMIDE |
MDL Number.: | MFCD04015011 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1cccc(c1NC(=O)CSc2nnc(n2N)c3cccc(c3)OC)C |
InChi: | InChI=1S/C19H21N5O2S/c1-12-6-4-7-13(2)17(12)21-16(25)11-27-19-23-22-18(24(19)20)14-8-5-9-15(10-14)26-3/h4-10H,11,20H2,1-3H3,(H,21,25) |
InChiKey: | InChIKey=SEYMVYZYJMVISM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.