* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-BROMOFURO[3,2-C]PYRIDINE |
CAS: | 76312-04-4 |
English Synonyms: | 4-BROMOFURO[3,2-C]PYRIDINE |
MDL Number.: | MFCD11869929 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cnc(c2c1occ2)Br |
InChi: | InChI=1S/C7H4BrNO/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H |
InChiKey: | InChIKey=LQSUGTMKGMENBG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.