* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-((4-(1H-1,2,4-TRIAZOL-1-YL)ANILINO)METHYL)BENZENOL |
CAS: | 763126-18-7 |
English Synonyms: | 2-((4-(1H-1,2,4-TRIAZOL-1-YL)ANILINO)METHYL)PHENOL ; 2-((4-(1H-1,2,4-TRIAZOL-1-YL)ANILINO)METHYL)BENZENOL |
MDL Number.: | MFCD05155037 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(c(c1)CNc2ccc(cc2)n3cncn3)O |
InChi: | InChI=1S/C15H14N4O/c20-15-4-2-1-3-12(15)9-17-13-5-7-14(8-6-13)19-11-16-10-18-19/h1-8,10-11,17,20H,9H2 |
InChiKey: | InChIKey=NDQIUIGWJOIATQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.