* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-ALLYL-7-PHENYL-1H-PYRIMIDO[4,5-D][1,3]OXAZINE-2,4-DIONE |
CAS: | 76360-66-2 |
English Synonyms: | 1-ALLYL-7-PHENYL-1H-PYRIMIDO[4,5-D][1,3]OXAZINE-2,4-DIONE ; 7-PHENYL-1-(2-PROPEN-1-YL)-2H-PYRIMIDO[4,5-D][1,3]OXAZINE-2,4(1H)-DIONE |
MDL Number.: | MFCD17011953 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | C=CCn1c2c(cnc(n2)c3ccccc3)c(=O)oc1=O |
InChi: | InChI=1S/C15H11N3O3/c1-2-8-18-13-11(14(19)21-15(18)20)9-16-12(17-13)10-6-4-3-5-7-10/h2-7,9H,1,8H2 |
InChiKey: | InChIKey=GGKUZJDSFNXJIF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.