* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(PIPERAZIN-1-YL)-1H-INDAZOLE |
CAS: | 763910-07-2 |
English Synonyms: | 6-(PIPERAZIN-1-YL)-1H-INDAZOLE |
MDL Number.: | MFCD13193488 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc2cn[nH]c2cc1N3CCNCC3 |
InChi: | InChI=1S/C11H14N4/c1-2-10(15-5-3-12-4-6-15)7-11-9(1)8-13-14-11/h1-2,7-8,12H,3-6H2,(H,13,14) |
InChiKey: | InChIKey=SAOSRZZZVNSGKU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.