* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YUANHUADINE |
| CAS: | 76402-66-9 |
| English Synonyms: | YUANHUADINE |
| MDL Number.: | MFCD01684120 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | CCCCC/C=C/C=C/[C@]12O[C@@H]3[C@@H]4[C@H]5[C@](O5)([C@H]([C@]6(C([C@@]4(O1)[C@@H]([C@H]([C@@]3(O2)C(=C)C)OC(=O)C)C)C=C(C6=O)C)O)O)CO |
| InChi: | InChI=1S/C32H42O10/c1-7-8-9-10-11-12-13-14-29-40-26-22-25-28(16-33,39-25)27(36)30(37)21(15-18(4)23(30)35)32(22,42-29)19(5)24(38-20(6)34)31(26,41-29)17(2)3/h11-15,19,21-22,24-27,33,36-37H,2,7-10,16H2,1,3-6H3/b12-11+,14-13+/t19-,21?,22+,24-,25+,26-,27-,28+,29-,30-,31+,32+/m1/s1 |
| InChiKey: | InChIKey=NHELFTYSELEEFD-UAGWEWCUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.