* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CHLORO-3,5-DIMETHOXYPYRIDINE |
| CAS: | 765257-23-6 |
| English Synonyms: | 2-CHLORO-3,5-DIMETHOXYPYRIDINE |
| MDL Number.: | MFCD16610309 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | COc1cc(c(nc1)Cl)OC |
| InChi: | InChI=1S/C7H8ClNO2/c1-10-5-3-6(11-2)7(8)9-4-5/h3-4H,1-2H3 |
| InChiKey: | InChIKey=ORHJHYLXRPBAAV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.