* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,5-DIOXA-SPIRO[5.5]UNDECAN-9-OL |
CAS: | 76626-10-3 |
English Synonyms: | 1,5-DIOXA-SPIRO[5.5]UNDECAN-9-OL |
MDL Number.: | MFCD11041027 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1COC2(CCC(CC2)O)OC1 |
InChi: | InChI=1S/C9H16O3/c10-8-2-4-9(5-3-8)11-6-1-7-12-9/h8,10H,1-7H2 |
InChiKey: | InChIKey=ZFWZLNKEOHMKMN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.