* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(BICYCLO[2.2.1]HEPTAN-2-YL)ACETAMIDE |
CAS: | 76649-95-1 |
English Synonyms: | 2-(BICYCLO[2.2.1]HEPTAN-2-YL)ACETAMIDE |
MDL Number.: | MFCD17167235 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1C[C@H]2C[C@@H]1CC2CC(=O)N |
InChi: | InChI=1S/C9H15NO/c10-9(11)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2,(H2,10,11)/t6-,7+,8?/m1/s1 |
InChiKey: | InChIKey=ISSWXMLAKJICEO-KVARREAHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.