* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-METHYL-1H-INDENE |
CAS: | 767-60-2 |
English Synonyms: | 3-METHYL-1H-INDENE ; 3-METHYL INDENE |
MDL Number.: | MFCD00674487 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1=CCc2c1cccc2 |
InChi: | InChI=1S/C10H10/c1-8-6-7-9-4-2-3-5-10(8)9/h2-6H,7H2,1H3 |
InChiKey: | InChIKey=COOKKJGOGWACMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.